C16H15Cl2N3O2 — CID 109167430
N-(2,3-dichlorophenyl)-2-morpholin-4-ylpyridine-4-carboxamide (PubChem CID 109167430) has the molecular formula C16H15Cl2N3O2 and a molecular weight of 352.22 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-morpholin-4-ylpyridine-4-carboxamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-morpholin-4-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 109167430 |
| Molecular Formula | C16H15Cl2N3O2 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-morpholin-4-ylpyridine-4-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1Cl)c1ccnc(N2CCOCC2)c1 |
| InChI | InChI=1S/C16H15Cl2N3O2/c17-12-2-1-3-13(15(12)18)20-16(22)11-4-5-19-14(10-11)21-6-8-23-9-7-21/h1-5,10H,6-9H2,(H,20,22) |
| InChIKey | QQRHMKKTELOCLP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |