C23H30BN3O4 — CID 67061351
N-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-morpholin-4-ylpyridine-4-carboxamide (PubChem CID 67061351) has the molecular formula C23H30BN3O4 and a molecular weight of 423.32 g/mol. Its IUPAC name is N-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-morpholin-4-ylpyridine-4-carboxamide.
| Compound Name | N-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-morpholin-4-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 67061351 |
| Molecular Formula | C23H30BN3O4 |
| Molecular Weight | 423.32 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | N-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-morpholin-4-ylpyridine-4-carboxamide |
| SMILES | Cc1c(NC(=O)c2ccnc(N3CCOCC3)c2)cccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C23H30BN3O4/c1-16-18(24-30-22(2,3)23(4,5)31-24)7-6-8-19(16)26-21(28)17-9-10-25-20(15-17)27-11-13-29-14-12-27/h6-10,15H,11-14H2,1-5H3,(H,26,28) |
| InChIKey | YOWDPZDMJGMPHX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|