C23H30BN3O3 — CID 11258289
N-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-pyrrolidin-1-ylpyridine-4-carboxamide (PubChem CID 11258289) has the molecular formula C23H30BN3O3 and a molecular weight of 407.32 g/mol. Its IUPAC name is N-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-pyrrolidin-1-ylpyridine-4-carboxamide.
| Compound Name | N-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-pyrrolidin-1-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 11258289 |
| Molecular Formula | C23H30BN3O3 |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | N-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-pyrrolidin-1-ylpyridine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccnc(N3CCCC3)c2)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C23H30BN3O3/c1-16-8-9-18(15-19(16)24-29-22(2,3)23(4,5)30-24)26-21(28)17-10-11-25-20(14-17)27-12-6-7-13-27/h8-11,14-15H,6-7,12-13H2,1-5H3,(H,26,28) |
| InChIKey | QXSQYQQZUNRHCG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|