C36H38BF2IN2O4 — CID 159302693
3-fluoro-N-(3-iodo-4-methylphenyl)-4-methylbenzamide;3-fluoro-4-methyl-N-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide (PubChem CID 159302693) has the molecular formula C36H38BF2IN2O4 and a molecular weight of 738.42 g/mol. Its IUPAC name is 3-fluoro-N-(3-iodo-4-methylphenyl)-4-methylbenzamide;3-fluoro-4-methyl-N-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide.
| Compound Name | 3-fluoro-N-(3-iodo-4-methylphenyl)-4-methylbenzamide;3-fluoro-4-methyl-N-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 159302693 |
| Molecular Formula | C36H38BF2IN2O4 |
| Molecular Weight | 738.42 g/mol |
| Exact Mass | 738.19 |
| IUPAC Name | 3-fluoro-N-(3-iodo-4-methylphenyl)-4-methylbenzamide;3-fluoro-4-methyl-N-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(C)c(B3OC(C)(C)C(C)(C)O3)c2)cc1F.Cc1ccc(C(=O)Nc2ccc(C)c(I)c2)cc1F |
| InChI | InChI=1S/C21H25BFNO3.C15H13FINO/c1-13-8-10-16(24-19(25)15-9-7-14(2)18(23)11-15)12-17(13)22-26-20(3,4)21(5,6)27-22;1-9-3-5-11(7-13(9)16)15(19)18-12-6-4-10(2)14(17)8-12/h7-12H,1-6H3,(H,24,25);3-8H,1-2H3,(H,18,19) |
| InChIKey | LBNMNIRTEFAKJE-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.42 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|