C21H26N4O — CID 109166232
2-piperidin-1-yl-N-(4-pyrrolidin-1-ylphenyl)pyridine-4-carboxamide (PubChem CID 109166232) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is 2-piperidin-1-yl-N-(4-pyrrolidin-1-ylphenyl)pyridine-4-carboxamide.
| Compound Name | 2-piperidin-1-yl-N-(4-pyrrolidin-1-ylphenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109166232 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 2-piperidin-1-yl-N-(4-pyrrolidin-1-ylphenyl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)cc1)c1ccnc(N2CCCCC2)c1 |
| InChI | InChI=1S/C21H26N4O/c26-21(17-10-11-22-20(16-17)25-14-2-1-3-15-25)23-18-6-8-19(9-7-18)24-12-4-5-13-24/h6-11,16H,1-5,12-15H2,(H,23,26) |
| InChIKey | AMXSWSFSRSLPFC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|