C24H23N5O — CID 109178749
N-(4-cyanophenyl)-2-(4-piperidin-1-ylanilino)pyridine-4-carboxamide (PubChem CID 109178749) has the molecular formula C24H23N5O and a molecular weight of 397.48 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2-(4-piperidin-1-ylanilino)pyridine-4-carboxamide.
| Compound Name | N-(4-cyanophenyl)-2-(4-piperidin-1-ylanilino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109178749 |
| Molecular Formula | C24H23N5O |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | N-(4-cyanophenyl)-2-(4-piperidin-1-ylanilino)pyridine-4-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)c2ccnc(Nc3ccc(N4CCCCC4)cc3)c2)cc1 |
| InChI | InChI=1S/C24H23N5O/c25-17-18-4-6-21(7-5-18)28-24(30)19-12-13-26-23(16-19)27-20-8-10-22(11-9-20)29-14-2-1-3-15-29/h4-13,16H,1-3,14-15H2,(H,26,27)(H,28,30) |
| InChIKey | BEUFULRDBHRAPR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|