C23H22N6O — CID 109359625
N-(4-cyanophenyl)-6-(4-piperidin-1-ylanilino)pyrimidine-4-carboxamide (PubChem CID 109359625) has the molecular formula C23H22N6O and a molecular weight of 398.47 g/mol. Its IUPAC name is N-(4-cyanophenyl)-6-(4-piperidin-1-ylanilino)pyrimidine-4-carboxamide.
| Compound Name | N-(4-cyanophenyl)-6-(4-piperidin-1-ylanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109359625 |
| Molecular Formula | C23H22N6O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | N-(4-cyanophenyl)-6-(4-piperidin-1-ylanilino)pyrimidine-4-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)c2cc(Nc3ccc(N4CCCCC4)cc3)ncn2)cc1 |
| InChI | InChI=1S/C23H22N6O/c24-15-17-4-6-19(7-5-17)28-23(30)21-14-22(26-16-25-21)27-18-8-10-20(11-9-18)29-12-2-1-3-13-29/h4-11,14,16H,1-3,12-13H2,(H,28,30)(H,25,26,27) |
| InChIKey | CAZIPJUQQGTWAH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|