C20H18N6O — CID 109359568
N-(4-cyanophenyl)-6-[4-(dimethylamino)anilino]pyrimidine-4-carboxamide (PubChem CID 109359568) has the molecular formula C20H18N6O and a molecular weight of 358.41 g/mol. Its IUPAC name is N-(4-cyanophenyl)-6-[4-(dimethylamino)anilino]pyrimidine-4-carboxamide.
| Compound Name | N-(4-cyanophenyl)-6-[4-(dimethylamino)anilino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109359568 |
| Molecular Formula | C20H18N6O |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-(4-cyanophenyl)-6-[4-(dimethylamino)anilino]pyrimidine-4-carboxamide |
| SMILES | CN(C)c1ccc(Nc2cc(C(=O)Nc3ccc(C#N)cc3)ncn2)cc1 |
| InChI | InChI=1S/C20H18N6O/c1-26(2)17-9-7-15(8-10-17)24-19-11-18(22-13-23-19)20(27)25-16-5-3-14(12-21)4-6-16/h3-11,13H,1-2H3,(H,25,27)(H,22,23,24) |
| InChIKey | ICITXIOUYTWFTI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|