C16H18N6O — CID 109344404
6-(4-cyanoanilino)-N-[2-(dimethylamino)ethyl]pyrimidine-4-carboxamide (PubChem CID 109344404) has the molecular formula C16H18N6O and a molecular weight of 310.36 g/mol. Its IUPAC name is 6-(4-cyanoanilino)-N-[2-(dimethylamino)ethyl]pyrimidine-4-carboxamide.
| Compound Name | 6-(4-cyanoanilino)-N-[2-(dimethylamino)ethyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109344404 |
| Molecular Formula | C16H18N6O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 6-(4-cyanoanilino)-N-[2-(dimethylamino)ethyl]pyrimidine-4-carboxamide |
| SMILES | CN(C)CCNC(=O)c1cc(Nc2ccc(C#N)cc2)ncn1 |
| InChI | InChI=1S/C16H18N6O/c1-22(2)8-7-18-16(23)14-9-15(20-11-19-14)21-13-5-3-12(10-17)4-6-13/h3-6,9,11H,7-8H2,1-2H3,(H,18,23)(H,19,20,21) |
| InChIKey | RXAJWYZCXZTLFQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |