C19H26N6O — CID 109344367
N-[2-(dimethylamino)ethyl]-6-(4-pyrrolidin-1-ylanilino)pyrimidine-4-carboxamide (PubChem CID 109344367) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-6-(4-pyrrolidin-1-ylanilino)pyrimidine-4-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-6-(4-pyrrolidin-1-ylanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109344367 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-6-(4-pyrrolidin-1-ylanilino)pyrimidine-4-carboxamide |
| SMILES | CN(C)CCNC(=O)c1cc(Nc2ccc(N3CCCC3)cc2)ncn1 |
| InChI | InChI=1S/C19H26N6O/c1-24(2)12-9-20-19(26)17-13-18(22-14-21-17)23-15-5-7-16(8-6-15)25-10-3-4-11-25/h5-8,13-14H,3-4,9-12H2,1-2H3,(H,20,26)(H,21,22,23) |
| InChIKey | JWCYWRRLZDMYTC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|