C20H25N5O2 — CID 109344010
N-(oxolan-2-ylmethyl)-6-(4-pyrrolidin-1-ylanilino)pyrimidine-4-carboxamide (PubChem CID 109344010) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-6-(4-pyrrolidin-1-ylanilino)pyrimidine-4-carboxamide.
| Compound Name | N-(oxolan-2-ylmethyl)-6-(4-pyrrolidin-1-ylanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109344010 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-6-(4-pyrrolidin-1-ylanilino)pyrimidine-4-carboxamide |
| SMILES | O=C(NCC1CCCO1)c1cc(Nc2ccc(N3CCCC3)cc2)ncn1 |
| InChI | InChI=1S/C20H25N5O2/c26-20(21-13-17-4-3-11-27-17)18-12-19(23-14-22-18)24-15-5-7-16(8-6-15)25-9-1-2-10-25/h5-8,12,14,17H,1-4,9-11,13H2,(H,21,26)(H,22,23,24) |
| InChIKey | HNSTYROOCOVRBL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|