C16H15F3N4O2 — CID 109344046
N-(oxolan-2-ylmethyl)-6-(2,3,4-trifluoroanilino)pyrimidine-4-carboxamide (PubChem CID 109344046) has the molecular formula C16H15F3N4O2 and a molecular weight of 352.32 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-6-(2,3,4-trifluoroanilino)pyrimidine-4-carboxamide.
| Compound Name | N-(oxolan-2-ylmethyl)-6-(2,3,4-trifluoroanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109344046 |
| Molecular Formula | C16H15F3N4O2 |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-6-(2,3,4-trifluoroanilino)pyrimidine-4-carboxamide |
| SMILES | O=C(NCC1CCCO1)c1cc(Nc2ccc(F)c(F)c2F)ncn1 |
| InChI | InChI=1S/C16H15F3N4O2/c17-10-3-4-11(15(19)14(10)18)23-13-6-12(21-8-22-13)16(24)20-7-9-2-1-5-25-9/h3-4,6,8-9H,1-2,5,7H2,(H,20,24)(H,21,22,23) |
| InChIKey | HBPJSFVPRUPRDN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|