C17H19FN4O2 — CID 109343891
6-[(4-fluorophenyl)methylamino]-N-(oxolan-2-ylmethyl)pyrimidine-4-carboxamide (PubChem CID 109343891) has the molecular formula C17H19FN4O2 and a molecular weight of 330.36 g/mol. Its IUPAC name is 6-[(4-fluorophenyl)methylamino]-N-(oxolan-2-ylmethyl)pyrimidine-4-carboxamide.
| Compound Name | 6-[(4-fluorophenyl)methylamino]-N-(oxolan-2-ylmethyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109343891 |
| Molecular Formula | C17H19FN4O2 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 6-[(4-fluorophenyl)methylamino]-N-(oxolan-2-ylmethyl)pyrimidine-4-carboxamide |
| SMILES | O=C(NCC1CCCO1)c1cc(NCc2ccc(F)cc2)ncn1 |
| InChI | InChI=1S/C17H19FN4O2/c18-13-5-3-12(4-6-13)9-19-16-8-15(21-11-22-16)17(23)20-10-14-2-1-7-24-14/h3-6,8,11,14H,1-2,7,9-10H2,(H,20,23)(H,19,21,22) |
| InChIKey | AAOXGCINUISZIF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |