C16H17FN4O2 — CID 109343844
N-(3-fluorophenyl)-6-(oxolan-2-ylmethylamino)pyrimidine-4-carboxamide (PubChem CID 109343844) has the molecular formula C16H17FN4O2 and a molecular weight of 316.34 g/mol. Its IUPAC name is N-(3-fluorophenyl)-6-(oxolan-2-ylmethylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(3-fluorophenyl)-6-(oxolan-2-ylmethylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109343844 |
| Molecular Formula | C16H17FN4O2 |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | N-(3-fluorophenyl)-6-(oxolan-2-ylmethylamino)pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)c1cc(NCC2CCCO2)ncn1 |
| InChI | InChI=1S/C16H17FN4O2/c17-11-3-1-4-12(7-11)21-16(22)14-8-15(20-10-19-14)18-9-13-5-2-6-23-13/h1,3-4,7-8,10,13H,2,5-6,9H2,(H,21,22)(H,18,19,20) |
| InChIKey | BOGHUWPFNUMKSV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |