C18H22N4O2 — CID 109343781
N-(2,4-dimethylphenyl)-6-(oxolan-2-ylmethylamino)pyrimidine-4-carboxamide (PubChem CID 109343781) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-6-(oxolan-2-ylmethylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-6-(oxolan-2-ylmethylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109343781 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N-(2,4-dimethylphenyl)-6-(oxolan-2-ylmethylamino)pyrimidine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(NCC3CCCO3)ncn2)c(C)c1 |
| InChI | InChI=1S/C18H22N4O2/c1-12-5-6-15(13(2)8-12)22-18(23)16-9-17(21-11-20-16)19-10-14-4-3-7-24-14/h5-6,8-9,11,14H,3-4,7,10H2,1-2H3,(H,22,23)(H,19,20,21) |
| InChIKey | FMXJLIUMXGORPA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |