C19H23N3O2 — CID 109185179
N-(2,4-dimethylphenyl)-5-(oxolan-2-ylmethylamino)pyridine-2-carboxamide (PubChem CID 109185179) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-5-(oxolan-2-ylmethylamino)pyridine-2-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-5-(oxolan-2-ylmethylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109185179 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | N-(2,4-dimethylphenyl)-5-(oxolan-2-ylmethylamino)pyridine-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(NCC3CCCO3)cn2)c(C)c1 |
| InChI | InChI=1S/C19H23N3O2/c1-13-5-7-17(14(2)10-13)22-19(23)18-8-6-15(11-21-18)20-12-16-4-3-9-24-16/h5-8,10-11,16,20H,3-4,9,12H2,1-2H3,(H,22,23) |
| InChIKey | UWAGCRJUOPYASY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |