C17H18FN3O2 — CID 109185196
N-(2-fluorophenyl)-5-(oxolan-2-ylmethylamino)pyridine-2-carboxamide (PubChem CID 109185196) has the molecular formula C17H18FN3O2 and a molecular weight of 315.35 g/mol. Its IUPAC name is N-(2-fluorophenyl)-5-(oxolan-2-ylmethylamino)pyridine-2-carboxamide.
| Compound Name | N-(2-fluorophenyl)-5-(oxolan-2-ylmethylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109185196 |
| Molecular Formula | C17H18FN3O2 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-(2-fluorophenyl)-5-(oxolan-2-ylmethylamino)pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1F)c1ccc(NCC2CCCO2)cn1 |
| InChI | InChI=1S/C17H18FN3O2/c18-14-5-1-2-6-15(14)21-17(22)16-8-7-12(10-20-16)19-11-13-4-3-9-23-13/h1-2,5-8,10,13,19H,3-4,9,11H2,(H,21,22) |
| InChIKey | QJMMPJPBUWYCMF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |