C14H22N4O2 — CID 112857188
4-N,6-N-bis(oxolan-2-ylmethyl)pyrimidine-4,6-diamine (PubChem CID 112857188) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 4-N,6-N-bis(oxolan-2-ylmethyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N,6-N-bis(oxolan-2-ylmethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112857188 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 4-N,6-N-bis(oxolan-2-ylmethyl)pyrimidine-4,6-diamine |
| SMILES | c1nc(NCC2CCCO2)cc(NCC2CCCO2)n1 |
| InChI | InChI=1S/C14H22N4O2/c1-3-11(19-5-1)8-15-13-7-14(18-10-17-13)16-9-12-4-2-6-20-12/h7,10-12H,1-6,8-9H2,(H2,15,16,17,18) |
| InChIKey | MNYDEQAQEJPJAY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |