C15H17N3O — CID 1408931
N-[[(2R)-oxolan-2-yl]methyl]-6-phenylpyrimidin-4-amine (PubChem CID 1408931) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is N-[[(2R)-oxolan-2-yl]methyl]-6-phenylpyrimidin-4-amine.
| Compound Name | N-[[(2R)-oxolan-2-yl]methyl]-6-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 1408931 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N-[[(2R)-oxolan-2-yl]methyl]-6-phenylpyrimidin-4-amine |
| SMILES | c1ccc(-c2cc(NC[C@H]3CCCO3)ncn2)cc1 |
| InChI | InChI=1S/C15H17N3O/c1-2-5-12(6-3-1)14-9-15(18-11-17-14)16-10-13-7-4-8-19-13/h1-3,5-6,9,11,13H,4,7-8,10H2,(H,16,17,18)/t13-/m1/s1 |
| InChIKey | NTKNQJNORNRBCB-CYBMUJFWSA-N |
| XLogP | 2.73 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |