C17H22N4O — CID 112857213
4-N-(oxolan-2-ylmethyl)-6-N-(2-phenylethyl)pyrimidine-4,6-diamine (PubChem CID 112857213) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is 4-N-(oxolan-2-ylmethyl)-6-N-(2-phenylethyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(oxolan-2-ylmethyl)-6-N-(2-phenylethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112857213 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 4-N-(oxolan-2-ylmethyl)-6-N-(2-phenylethyl)pyrimidine-4,6-diamine |
| SMILES | c1ccc(CCNc2cc(NCC3CCCO3)ncn2)cc1 |
| InChI | InChI=1S/C17H22N4O/c1-2-5-14(6-3-1)8-9-18-16-11-17(21-13-20-16)19-12-15-7-4-10-22-15/h1-3,5-6,11,13,15H,4,7-10,12H2,(H2,18,19,20,21) |
| InChIKey | HBFUZGWHUFVFGB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |