C19H24N4O2 — CID 109343757
6-(oxolan-2-ylmethylamino)-N-(3-phenylpropyl)pyrimidine-4-carboxamide (PubChem CID 109343757) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 6-(oxolan-2-ylmethylamino)-N-(3-phenylpropyl)pyrimidine-4-carboxamide.
| Compound Name | 6-(oxolan-2-ylmethylamino)-N-(3-phenylpropyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109343757 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 6-(oxolan-2-ylmethylamino)-N-(3-phenylpropyl)pyrimidine-4-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)c1cc(NCC2CCCO2)ncn1 |
| InChI | InChI=1S/C19H24N4O2/c24-19(20-10-4-8-15-6-2-1-3-7-15)17-12-18(23-14-22-17)21-13-16-9-5-11-25-16/h1-3,6-7,12,14,16H,4-5,8-11,13H2,(H,20,24)(H,21,22,23) |
| InChIKey | OLAYCQPPRFMUGI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|