C22H30N4O — CID 112880638
4-N-cycloheptyl-6-N-(oxolan-2-ylmethyl)-2-phenylpyrimidine-4,6-diamine (PubChem CID 112880638) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is 4-N-cycloheptyl-6-N-(oxolan-2-ylmethyl)-2-phenylpyrimidine-4,6-diamine.
| Compound Name | 4-N-cycloheptyl-6-N-(oxolan-2-ylmethyl)-2-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112880638 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 4-N-cycloheptyl-6-N-(oxolan-2-ylmethyl)-2-phenylpyrimidine-4,6-diamine |
| SMILES | c1ccc(-c2nc(NCC3CCCO3)cc(NC3CCCCCC3)n2)cc1 |
| InChI | InChI=1S/C22H30N4O/c1-2-7-12-18(11-6-1)24-21-15-20(23-16-19-13-8-14-27-19)25-22(26-21)17-9-4-3-5-10-17/h3-5,9-10,15,18-19H,1-2,6-8,11-14,16H2,(H2,23,24,25,26) |
| InChIKey | MSMVLJVVCPRELC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |