C15H24N4O — CID 112884929
2-N-cyclohexyl-4-N-(oxolan-2-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 112884929) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-N-cyclohexyl-4-N-(oxolan-2-ylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-cyclohexyl-4-N-(oxolan-2-ylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112884929 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 2-N-cyclohexyl-4-N-(oxolan-2-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | c1cc(NCC2CCCO2)nc(NC2CCCCC2)n1 |
| InChI | InChI=1S/C15H24N4O/c1-2-5-12(6-3-1)18-15-16-9-8-14(19-15)17-11-13-7-4-10-20-13/h8-9,12-13H,1-7,10-11H2,(H2,16,17,18,19) |
| InChIKey | SHVHWSVITKRNIX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |