C9H14N4O — CID 80772162
4-N-(oxolan-2-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 80772162) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is 4-N-(oxolan-2-ylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(oxolan-2-ylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80772162 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 4-N-(oxolan-2-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | Nc1nccc(NCC2CCCO2)n1 |
| InChI | InChI=1S/C9H14N4O/c10-9-11-4-3-8(13-9)12-6-7-2-1-5-14-7/h3-4,7H,1-2,5-6H2,(H3,10,11,12,13) |
| InChIKey | ZOZHMHBMYDHZHD-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |