C10H16N4O2 — CID 103817391
6-methoxy-4-N-(oxolan-2-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 103817391) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 6-methoxy-4-N-(oxolan-2-ylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 6-methoxy-4-N-(oxolan-2-ylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 103817391 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 6-methoxy-4-N-(oxolan-2-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | COc1cc(NCC2CCCO2)nc(N)n1 |
| InChI | InChI=1S/C10H16N4O2/c1-15-9-5-8(13-10(11)14-9)12-6-7-3-2-4-16-7/h5,7H,2-4,6H2,1H3,(H3,11,12,13,14) |
| InChIKey | NYUCVPWEBZRMGN-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |