C11H18N4O — CID 79825613
6-N-(oxan-2-ylmethyl)pyridine-2,3,6-triamine (PubChem CID 79825613) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is 6-N-(oxan-2-ylmethyl)pyridine-2,3,6-triamine.
| Compound Name | 6-N-(oxan-2-ylmethyl)pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 79825613 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 6-N-(oxan-2-ylmethyl)pyridine-2,3,6-triamine |
| SMILES | Nc1ccc(NCC2CCCCO2)nc1N |
| InChI | InChI=1S/C11H18N4O/c12-9-4-5-10(15-11(9)13)14-7-8-3-1-2-6-16-8/h4-5,8H,1-3,6-7,12H2,(H3,13,14,15) |
| InChIKey | UFXGYGFDXFYXKT-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |