C14H17N3O — CID 43383029
2-N-(oxolan-2-ylmethyl)quinoline-2,6-diamine (PubChem CID 43383029) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is 2-N-(oxolan-2-ylmethyl)quinoline-2,6-diamine.
| Compound Name | 2-N-(oxolan-2-ylmethyl)quinoline-2,6-diamine |
|---|---|
| PubChem CID | 43383029 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 2-N-(oxolan-2-ylmethyl)quinoline-2,6-diamine |
| SMILES | Nc1ccc2nc(NCC3CCCO3)ccc2c1 |
| InChI | InChI=1S/C14H17N3O/c15-11-4-5-13-10(8-11)3-6-14(17-13)16-9-12-2-1-7-18-12/h3-6,8,12H,1-2,7,9,15H2,(H,16,17) |
| InChIKey | QFUMRHSAFYMDHW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|