C11H19N5O — CID 114401447
4-N-[(4-ethylmorpholin-2-yl)methyl]pyrimidine-2,4-diamine (PubChem CID 114401447) has the molecular formula C11H19N5O and a molecular weight of 237.31 g/mol. Its IUPAC name is 4-N-[(4-ethylmorpholin-2-yl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[(4-ethylmorpholin-2-yl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 114401447 |
| Molecular Formula | C11H19N5O |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 4-N-[(4-ethylmorpholin-2-yl)methyl]pyrimidine-2,4-diamine |
| SMILES | CCN1CCOC(CNc2ccnc(N)n2)C1 |
| InChI | InChI=1S/C11H19N5O/c1-2-16-5-6-17-9(8-16)7-14-10-3-4-13-11(12)15-10/h3-4,9H,2,5-8H2,1H3,(H3,12,13,14,15) |
| InChIKey | JUFCZHGDAWUKGF-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |