C12H20N4O — CID 114399235
4-N-[(4-ethylmorpholin-2-yl)methyl]pyridine-3,4-diamine (PubChem CID 114399235) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is 4-N-[(4-ethylmorpholin-2-yl)methyl]pyridine-3,4-diamine.
| Compound Name | 4-N-[(4-ethylmorpholin-2-yl)methyl]pyridine-3,4-diamine |
|---|---|
| PubChem CID | 114399235 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 4-N-[(4-ethylmorpholin-2-yl)methyl]pyridine-3,4-diamine |
| SMILES | CCN1CCOC(CNc2ccncc2N)C1 |
| InChI | InChI=1S/C12H20N4O/c1-2-16-5-6-17-10(9-16)7-15-12-3-4-14-8-11(12)13/h3-4,8,10H,2,5-7,9,13H2,1H3,(H,14,15) |
| InChIKey | NADDIOPPMSCRSH-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |