C15H19BrN4O — CID 116646580
7-bromo-N-[(4-ethylmorpholin-2-yl)methyl]-1,5-naphthyridin-4-amine (PubChem CID 116646580) has the molecular formula C15H19BrN4O and a molecular weight of 351.25 g/mol. Its IUPAC name is 7-bromo-N-[(4-ethylmorpholin-2-yl)methyl]-1,5-naphthyridin-4-amine.
| Compound Name | 7-bromo-N-[(4-ethylmorpholin-2-yl)methyl]-1,5-naphthyridin-4-amine |
|---|---|
| PubChem CID | 116646580 |
| Molecular Formula | C15H19BrN4O |
| Molecular Weight | 351.25 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 7-bromo-N-[(4-ethylmorpholin-2-yl)methyl]-1,5-naphthyridin-4-amine |
| SMILES | CCN1CCOC(CNc2ccnc3cc(Br)cnc23)C1 |
| InChI | InChI=1S/C15H19BrN4O/c1-2-20-5-6-21-12(10-20)9-18-13-3-4-17-14-7-11(16)8-19-15(13)14/h3-4,7-8,12H,2,5-6,9-10H2,1H3,(H,17,18) |
| InChIKey | DYAIFRRGKYNWFV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |