C21H24N4O — CID 112880164
4-N-cyclohexyl-6-N-(furan-2-ylmethyl)-2-phenylpyrimidine-4,6-diamine (PubChem CID 112880164) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is 4-N-cyclohexyl-6-N-(furan-2-ylmethyl)-2-phenylpyrimidine-4,6-diamine.
| Compound Name | 4-N-cyclohexyl-6-N-(furan-2-ylmethyl)-2-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112880164 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 4-N-cyclohexyl-6-N-(furan-2-ylmethyl)-2-phenylpyrimidine-4,6-diamine |
| SMILES | c1ccc(-c2nc(NCc3ccco3)cc(NC3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C21H24N4O/c1-3-8-16(9-4-1)21-24-19(22-15-18-12-7-13-26-18)14-20(25-21)23-17-10-5-2-6-11-17/h1,3-4,7-9,12-14,17H,2,5-6,10-11,15H2,(H2,22,23,24,25) |
| InChIKey | BPJQMRUYRIQIKA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |