C20H16N4O — CID 3314360
N-(furan-2-ylmethyl)-6-phenyl-2-pyridin-2-ylpyrimidin-4-amine (PubChem CID 3314360) has the molecular formula C20H16N4O and a molecular weight of 328.38 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-6-phenyl-2-pyridin-2-ylpyrimidin-4-amine.
| Compound Name | N-(furan-2-ylmethyl)-6-phenyl-2-pyridin-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 3314360 |
| Molecular Formula | C20H16N4O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | N-(furan-2-ylmethyl)-6-phenyl-2-pyridin-2-ylpyrimidin-4-amine |
| SMILES | c1ccc(-c2cc(NCc3ccco3)nc(-c3ccccn3)n2)cc1 |
| InChI | InChI=1S/C20H16N4O/c1-2-7-15(8-3-1)18-13-19(22-14-16-9-6-12-25-16)24-20(23-18)17-10-4-5-11-21-17/h1-13H,14H2,(H,22,23,24) |
| InChIKey | MLBIXHJEQYIEEW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |