C18H20N4O — CID 112932522
4-N-(furan-2-ylmethyl)-6-phenyl-2-N-propylpyrimidine-2,4-diamine (PubChem CID 112932522) has the molecular formula C18H20N4O and a molecular weight of 308.38 g/mol. Its IUPAC name is 4-N-(furan-2-ylmethyl)-6-phenyl-2-N-propylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(furan-2-ylmethyl)-6-phenyl-2-N-propylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112932522 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 4-N-(furan-2-ylmethyl)-6-phenyl-2-N-propylpyrimidine-2,4-diamine |
| SMILES | CCCNc1nc(NCc2ccco2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H20N4O/c1-2-10-19-18-21-16(14-7-4-3-5-8-14)12-17(22-18)20-13-15-9-6-11-23-15/h3-9,11-12H,2,10,13H2,1H3,(H2,19,20,21,22) |
| InChIKey | AHAVMPXNZSXSII-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |