C20H28N4 — CID 112880067
4-N-cyclopentyl-6-N-(3-methylbutyl)-2-phenylpyrimidine-4,6-diamine (PubChem CID 112880067) has the molecular formula C20H28N4 and a molecular weight of 324.47 g/mol. Its IUPAC name is 4-N-cyclopentyl-6-N-(3-methylbutyl)-2-phenylpyrimidine-4,6-diamine.
| Compound Name | 4-N-cyclopentyl-6-N-(3-methylbutyl)-2-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112880067 |
| Molecular Formula | C20H28N4 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 4-N-cyclopentyl-6-N-(3-methylbutyl)-2-phenylpyrimidine-4,6-diamine |
| SMILES | CC(C)CCNc1cc(NC2CCCC2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H28N4/c1-15(2)12-13-21-18-14-19(22-17-10-6-7-11-17)24-20(23-18)16-8-4-3-5-9-16/h3-5,8-9,14-15,17H,6-7,10-13H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | PUKVCHOWFDVZBZ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |