C23H26N4O — CID 112880661
4-N-ethyl-6-N-(oxolan-2-ylmethyl)-4-N,2-diphenylpyrimidine-4,6-diamine (PubChem CID 112880661) has the molecular formula C23H26N4O and a molecular weight of 374.49 g/mol. Its IUPAC name is 4-N-ethyl-6-N-(oxolan-2-ylmethyl)-4-N,2-diphenylpyrimidine-4,6-diamine.
| Compound Name | 4-N-ethyl-6-N-(oxolan-2-ylmethyl)-4-N,2-diphenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112880661 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 4-N-ethyl-6-N-(oxolan-2-ylmethyl)-4-N,2-diphenylpyrimidine-4,6-diamine |
| SMILES | CCN(c1ccccc1)c1cc(NCC2CCCO2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H26N4O/c1-2-27(19-12-7-4-8-13-19)22-16-21(24-17-20-14-9-15-28-20)25-23(26-22)18-10-5-3-6-11-18/h3-8,10-13,16,20H,2,9,14-15,17H2,1H3,(H,24,25,26) |
| InChIKey | YURDYSIUPYPELA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |