C17H22N4O — CID 112857277
4-N-ethyl-6-N-(oxolan-2-ylmethyl)-4-N-phenylpyrimidine-4,6-diamine (PubChem CID 112857277) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is 4-N-ethyl-6-N-(oxolan-2-ylmethyl)-4-N-phenylpyrimidine-4,6-diamine.
| Compound Name | 4-N-ethyl-6-N-(oxolan-2-ylmethyl)-4-N-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112857277 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 4-N-ethyl-6-N-(oxolan-2-ylmethyl)-4-N-phenylpyrimidine-4,6-diamine |
| SMILES | CCN(c1ccccc1)c1cc(NCC2CCCO2)ncn1 |
| InChI | InChI=1S/C17H22N4O/c1-2-21(14-7-4-3-5-8-14)17-11-16(19-13-20-17)18-12-15-9-6-10-22-15/h3-5,7-8,11,13,15H,2,6,9-10,12H2,1H3,(H,18,19,20) |
| InChIKey | ZDBCOJMPASWTHS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |