C20H27N5O — CID 112880607
6-(4-methylpiperazin-1-yl)-N-(oxolan-2-ylmethyl)-2-phenylpyrimidin-4-amine (PubChem CID 112880607) has the molecular formula C20H27N5O and a molecular weight of 353.47 g/mol. Its IUPAC name is 6-(4-methylpiperazin-1-yl)-N-(oxolan-2-ylmethyl)-2-phenylpyrimidin-4-amine.
| Compound Name | 6-(4-methylpiperazin-1-yl)-N-(oxolan-2-ylmethyl)-2-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112880607 |
| Molecular Formula | C20H27N5O |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 6-(4-methylpiperazin-1-yl)-N-(oxolan-2-ylmethyl)-2-phenylpyrimidin-4-amine |
| SMILES | CN1CCN(c2cc(NCC3CCCO3)nc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C20H27N5O/c1-24-9-11-25(12-10-24)19-14-18(21-15-17-8-5-13-26-17)22-20(23-19)16-6-3-2-4-7-16/h2-4,6-7,14,17H,5,8-13,15H2,1H3,(H,21,22,23) |
| InChIKey | JMTOAQMUEUENLL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |