C16H20N4O2 — CID 112857301
4-N-(2-methoxyphenyl)-6-N-(oxolan-2-ylmethyl)pyrimidine-4,6-diamine (PubChem CID 112857301) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 4-N-(2-methoxyphenyl)-6-N-(oxolan-2-ylmethyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(2-methoxyphenyl)-6-N-(oxolan-2-ylmethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112857301 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 4-N-(2-methoxyphenyl)-6-N-(oxolan-2-ylmethyl)pyrimidine-4,6-diamine |
| SMILES | COc1ccccc1Nc1cc(NCC2CCCO2)ncn1 |
| InChI | InChI=1S/C16H20N4O2/c1-21-14-7-3-2-6-13(14)20-16-9-15(18-11-19-16)17-10-12-5-4-8-22-12/h2-3,6-7,9,11-12H,4-5,8,10H2,1H3,(H2,17,18,19,20) |
| InChIKey | LIKJTVOPTICBFD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |