C18H21FN3O2+ — CID 7382822
6-[(4-fluorophenyl)methylamino]-N-[[(2R)-oxolan-2-yl]methyl]pyridin-1-ium-3-carboxamide (PubChem CID 7382822) has the molecular formula C18H21FN3O2+ and a molecular weight of 330.38 g/mol. Its IUPAC name is 6-[(4-fluorophenyl)methylamino]-N-[[(2R)-oxolan-2-yl]methyl]pyridin-1-ium-3-carboxamide.
| Compound Name | 6-[(4-fluorophenyl)methylamino]-N-[[(2R)-oxolan-2-yl]methyl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 7382822 |
| Molecular Formula | C18H21FN3O2+ |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 6-[(4-fluorophenyl)methylamino]-N-[[(2R)-oxolan-2-yl]methyl]pyridin-1-ium-3-carboxamide |
| SMILES | O=C(NC[C@H]1CCCO1)c1ccc(NCc2ccc(F)cc2)[nH+]c1 |
| InChI | InChI=1S/C18H20FN3O2/c19-15-6-3-13(4-7-15)10-20-17-8-5-14(11-21-17)18(23)22-12-16-2-1-9-24-16/h3-8,11,16H,1-2,9-10,12H2,(H,20,21)(H,22,23)/p+1/t16-/m1/s1 |
| InChIKey | YTTHEKBVLPYYAU-MRXNPFEDSA-O |
| XLogP | 2.16 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |