C15H22N3O2+ — CID 7130464
N-[[(2S)-oxolan-2-yl]methyl]-6-pyrrolidin-1-ylpyridin-1-ium-3-carboxamide (PubChem CID 7130464) has the molecular formula C15H22N3O2+ and a molecular weight of 276.36 g/mol. Its IUPAC name is N-[[(2S)-oxolan-2-yl]methyl]-6-pyrrolidin-1-ylpyridin-1-ium-3-carboxamide.
| Compound Name | N-[[(2S)-oxolan-2-yl]methyl]-6-pyrrolidin-1-ylpyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 7130464 |
| Molecular Formula | C15H22N3O2+ |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | N-[[(2S)-oxolan-2-yl]methyl]-6-pyrrolidin-1-ylpyridin-1-ium-3-carboxamide |
| SMILES | O=C(NC[C@@H]1CCCO1)c1ccc(N2CCCC2)[nH+]c1 |
| InChI | InChI=1S/C15H21N3O2/c19-15(17-11-13-4-3-9-20-13)12-5-6-14(16-10-12)18-7-1-2-8-18/h5-6,10,13H,1-4,7-9,11H2,(H,17,19)/p+1/t13-/m0/s1 |
| InChIKey | RNBBEXMLIYVJBJ-ZDUSSCGKSA-O |
| XLogP | 1.01 |
| TPSA | 55.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |