C17H26N3O2+ — CID 7130482
6-(4-methylpiperidin-1-yl)-N-[[(2S)-oxolan-2-yl]methyl]pyridin-1-ium-3-carboxamide (PubChem CID 7130482) has the molecular formula C17H26N3O2+ and a molecular weight of 304.41 g/mol. Its IUPAC name is 6-(4-methylpiperidin-1-yl)-N-[[(2S)-oxolan-2-yl]methyl]pyridin-1-ium-3-carboxamide.
| Compound Name | 6-(4-methylpiperidin-1-yl)-N-[[(2S)-oxolan-2-yl]methyl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 7130482 |
| Molecular Formula | C17H26N3O2+ |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 6-(4-methylpiperidin-1-yl)-N-[[(2S)-oxolan-2-yl]methyl]pyridin-1-ium-3-carboxamide |
| SMILES | CC1CCN(c2ccc(C(=O)NC[C@@H]3CCCO3)c[nH+]2)CC1 |
| InChI | InChI=1S/C17H25N3O2/c1-13-6-8-20(9-7-13)16-5-4-14(11-18-16)17(21)19-12-15-3-2-10-22-15/h4-5,11,13,15H,2-3,6-10,12H2,1H3,(H,19,21)/p+1/t15-/m0/s1 |
| InChIKey | OSCMHJRGWNDUSU-HNNXBMFYSA-O |
| XLogP | 1.65 |
| TPSA | 55.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |