C25H30FN3O3 — CID 42757268
5-[(4-fluorobenzoyl)amino]-2-(4-methylpiperidin-1-yl)-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 42757268) has the molecular formula C25H30FN3O3 and a molecular weight of 439.53 g/mol. Its IUPAC name is 5-[(4-fluorobenzoyl)amino]-2-(4-methylpiperidin-1-yl)-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 5-[(4-fluorobenzoyl)amino]-2-(4-methylpiperidin-1-yl)-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 42757268 |
| Molecular Formula | C25H30FN3O3 |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 5-[(4-fluorobenzoyl)amino]-2-(4-methylpiperidin-1-yl)-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | CC1CCN(c2ccc(NC(=O)c3ccc(F)cc3)cc2C(=O)NCC2CCCO2)CC1 |
| InChI | InChI=1S/C25H30FN3O3/c1-17-10-12-29(13-11-17)23-9-8-20(28-24(30)18-4-6-19(26)7-5-18)15-22(23)25(31)27-16-21-3-2-14-32-21/h4-9,15,17,21H,2-3,10-14,16H2,1H3,(H,27,31)(H,28,30) |
| InChIKey | POUHCRWSSYNBTI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|