C30H33FN4O4 — CID 4992550
5-[(4-fluorobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 4992550) has the molecular formula C30H33FN4O4 and a molecular weight of 532.62 g/mol. Its IUPAC name is 5-[(4-fluorobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 5-[(4-fluorobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 4992550 |
| Molecular Formula | C30H33FN4O4 |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | 5-[(4-fluorobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)c3ccc(F)cc3)cc2C(=O)NCC2CCCO2)CC1 |
| InChI | InChI=1S/C30H33FN4O4/c1-38-28-7-3-2-6-27(28)35-16-14-34(15-17-35)26-13-12-23(33-29(36)21-8-10-22(31)11-9-21)19-25(26)30(37)32-20-24-5-4-18-39-24/h2-3,6-13,19,24H,4-5,14-18,20H2,1H3,(H,32,37)(H,33,36) |
| InChIKey | CMIOMFMXNVJAIB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|