C30H40N4O4 — CID 5177312
5-(cyclohexanecarbonylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 5177312) has the molecular formula C30H40N4O4 and a molecular weight of 520.67 g/mol. Its IUPAC name is 5-(cyclohexanecarbonylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 5-(cyclohexanecarbonylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 5177312 |
| Molecular Formula | C30H40N4O4 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | 5-(cyclohexanecarbonylamino)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)C3CCCCC3)cc2C(=O)NCC2CCCO2)CC1 |
| InChI | InChI=1S/C30H40N4O4/c1-37-28-12-6-5-11-27(28)34-17-15-33(16-18-34)26-14-13-23(32-29(35)22-8-3-2-4-9-22)20-25(26)30(36)31-21-24-10-7-19-38-24/h5-6,11-14,20,22,24H,2-4,7-10,15-19,21H2,1H3,(H,31,36)(H,32,35) |
| InChIKey | FGLNGKNUOMMHFJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|