C21H29N3O3 — CID 1055088
5-(cyclopropanecarbonylamino)-N-[[(2S)-oxolan-2-yl]methyl]-2-piperidin-1-ylbenzamide (PubChem CID 1055088) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 5-(cyclopropanecarbonylamino)-N-[[(2S)-oxolan-2-yl]methyl]-2-piperidin-1-ylbenzamide.
| Compound Name | 5-(cyclopropanecarbonylamino)-N-[[(2S)-oxolan-2-yl]methyl]-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 1055088 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 5-(cyclopropanecarbonylamino)-N-[[(2S)-oxolan-2-yl]methyl]-2-piperidin-1-ylbenzamide |
| SMILES | O=C(NC[C@@H]1CCCO1)c1cc(NC(=O)C2CC2)ccc1N1CCCCC1 |
| InChI | InChI=1S/C21H29N3O3/c25-20(15-6-7-15)23-16-8-9-19(24-10-2-1-3-11-24)18(13-16)21(26)22-14-17-5-4-12-27-17/h8-9,13,15,17H,1-7,10-12,14H2,(H,22,26)(H,23,25)/t17-/m0/s1 |
| InChIKey | HWFRMLLSLGZUJO-KRWDZBQOSA-N |
| XLogP | 2.93 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|