C24H27Cl2N3O3 — CID 5178487
5-[(3,5-dichlorobenzoyl)amino]-N-(oxolan-2-ylmethyl)-2-piperidin-1-ylbenzamide (PubChem CID 5178487) has the molecular formula C24H27Cl2N3O3 and a molecular weight of 476.40 g/mol. Its IUPAC name is 5-[(3,5-dichlorobenzoyl)amino]-N-(oxolan-2-ylmethyl)-2-piperidin-1-ylbenzamide.
| Compound Name | 5-[(3,5-dichlorobenzoyl)amino]-N-(oxolan-2-ylmethyl)-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 5178487 |
| Molecular Formula | C24H27Cl2N3O3 |
| Molecular Weight | 476.40 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 5-[(3,5-dichlorobenzoyl)amino]-N-(oxolan-2-ylmethyl)-2-piperidin-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)c(C(=O)NCC2CCCO2)c1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C24H27Cl2N3O3/c25-17-11-16(12-18(26)13-17)23(30)28-19-6-7-22(29-8-2-1-3-9-29)21(14-19)24(31)27-15-20-5-4-10-32-20/h6-7,11-14,20H,1-5,8-10,15H2,(H,27,31)(H,28,30) |
| InChIKey | RXMDRJNTSVUVNK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.40 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|