C25H32N4O5 — CID 3689843
5-[(3,5-dimethoxyphenyl)carbamoylamino]-N-(oxolan-2-ylmethyl)-2-pyrrolidin-1-ylbenzamide (PubChem CID 3689843) has the molecular formula C25H32N4O5 and a molecular weight of 468.55 g/mol. Its IUPAC name is 5-[(3,5-dimethoxyphenyl)carbamoylamino]-N-(oxolan-2-ylmethyl)-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-[(3,5-dimethoxyphenyl)carbamoylamino]-N-(oxolan-2-ylmethyl)-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 3689843 |
| Molecular Formula | C25H32N4O5 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 5-[(3,5-dimethoxyphenyl)carbamoylamino]-N-(oxolan-2-ylmethyl)-2-pyrrolidin-1-ylbenzamide |
| SMILES | COc1cc(NC(=O)Nc2ccc(N3CCCC3)c(C(=O)NCC3CCCO3)c2)cc(OC)c1 |
| InChI | InChI=1S/C25H32N4O5/c1-32-20-12-18(13-21(15-20)33-2)28-25(31)27-17-7-8-23(29-9-3-4-10-29)22(14-17)24(30)26-16-19-6-5-11-34-19/h7-8,12-15,19H,3-6,9-11,16H2,1-2H3,(H,26,30)(H2,27,28,31) |
| InChIKey | IOAQYHIBQTUCRJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|