C32H39N5O4 — CID 4643253
5-[(2,6-dimethylphenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 4643253) has the molecular formula C32H39N5O4 and a molecular weight of 557.70 g/mol. Its IUPAC name is 5-[(2,6-dimethylphenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 5-[(2,6-dimethylphenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 4643253 |
| Molecular Formula | C32H39N5O4 |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.30 |
| IUPAC Name | 5-[(2,6-dimethylphenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)Nc3c(C)cccc3C)cc2C(=O)NCC2CCCO2)CC1 |
| InChI | InChI=1S/C32H39N5O4/c1-22-8-6-9-23(2)30(22)35-32(39)34-24-13-14-27(26(20-24)31(38)33-21-25-10-7-19-41-25)36-15-17-37(18-16-36)28-11-4-5-12-29(28)40-3/h4-6,8-9,11-14,20,25H,7,10,15-19,21H2,1-3H3,(H,33,38)(H2,34,35,39) |
| InChIKey | LTVPNRLITFIUMV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|