C30H33F2N5O4 — CID 42756404
5-[(2,4-difluorophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 42756404) has the molecular formula C30H33F2N5O4 and a molecular weight of 565.62 g/mol. Its IUPAC name is 5-[(2,4-difluorophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 5-[(2,4-difluorophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 42756404 |
| Molecular Formula | C30H33F2N5O4 |
| Molecular Weight | 565.62 g/mol |
| Exact Mass | 565.25 |
| IUPAC Name | 5-[(2,4-difluorophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)Nc3ccc(F)cc3F)cc2C(=O)NCC2CCCO2)CC1 |
| InChI | InChI=1S/C30H33F2N5O4/c1-40-28-7-3-2-6-27(28)37-14-12-36(13-15-37)26-11-9-21(18-23(26)29(38)33-19-22-5-4-16-41-22)34-30(39)35-25-10-8-20(31)17-24(25)32/h2-3,6-11,17-18,22H,4-5,12-16,19H2,1H3,(H,33,38)(H2,34,35,39) |
| InChIKey | DSLTYFAWKHEBMY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|