C31H35F2N5O3 — CID 42659973
N-cyclohexyl-5-[(2,4-difluorophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 42659973) has the molecular formula C31H35F2N5O3 and a molecular weight of 563.65 g/mol. Its IUPAC name is N-cyclohexyl-5-[(2,4-difluorophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | N-cyclohexyl-5-[(2,4-difluorophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 42659973 |
| Molecular Formula | C31H35F2N5O3 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.27 |
| IUPAC Name | N-cyclohexyl-5-[(2,4-difluorophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)Nc3ccc(F)cc3F)cc2C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C31H35F2N5O3/c1-41-29-10-6-5-9-28(29)38-17-15-37(16-18-38)27-14-12-23(20-24(27)30(39)34-22-7-3-2-4-8-22)35-31(40)36-26-13-11-21(32)19-25(26)33/h5-6,9-14,19-20,22H,2-4,7-8,15-18H2,1H3,(H,34,39)(H2,35,36,40) |
| InChIKey | FHAMYWVTPSIOMY-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|